Wnt pathway activator 2
cas: 1360540-82-4 — see every product listed under this CAS number, including other names
Wnt pathway activator 2 (CAS 1360540-82-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM * 1mlindmso, 25mg, 5mg, 50mg, 1mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC70148-10 |
| cas | 1360540-82-4 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1467.61 Pln | |
| GLPBio | 100mg | 6101.31 Pln | |
| GLPBio | 10mM * 1mlindmso | 1109.55 Pln | |
| GLPBio | 25mg | 2731.35 Pln | |
| GLPBio | 5mg | 1046.37 Pln | |
| GLPBio | 50mg | 3995.08 Pln | |
| Chemat | 1mg | 237.20 Pln | |
| Chemat | 5mg | 558.80 Pln | |
| Chemat | 10mg | 866.00 Pln | |
| Chemat | 25mg | 1446.80 Pln | |
| Chemat | 50mg | 2066.00 Pln | |
| Chemat | 100mg | 2886.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione (CAS 1360540-82-4) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione. InChIKey: DMBCGEJVWBLNDP-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione |
| InChIKey | DMBCGEJVWBLNDP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCC(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)
Synonyms:
Wnt pathway activator 2, 1-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)-4-(pyridin-2-yl)butane-1,4-dione, orb1708218, orb2901677, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-(2-pyridinyl)-1,4-butanedione, Wnt pathway activator 2, 10 mM in DMSO, 1,4-Butanedione, 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-pyridinyl)-