Products 1360540-82-4
CAS 1360540-82-4 appears in our catalog under these names: Wnt pathway activator 2, 98%, Wnt pathway activator 2/ 98.28% (existing batch purity), Wnt pathway activator 2, Wnt pathway activator 2 98%, Wnt pathway activator 2. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM * 1mlindmso.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione (CAS 1360540-82-4) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione. InChIKey: DMBCGEJVWBLNDP-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione |
| InChIKey | DMBCGEJVWBLNDP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCC(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)
Synonyms:
Wnt pathway activator 2, 1-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)-4-(pyridin-2-yl)butane-1,4-dione, orb1708218, orb2901677, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-(2-pyridinyl)-1,4-butanedione, Wnt pathway activator 2, 10 mM in DMSO, 1,4-Butanedione, 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-pyridinyl)-