Products 887256-29-3
CAS 887256-29-3 appears in our catalog under these names: Potassium Clavulanate EP Impurity G Enantiomer , Potassium Clavulanate EP Impurity G Enantiomer(R-isomers). Offered by: Chemat Brand. Available pack sizes: on request.
4-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid (CAS 887256-29-3) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: 4-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid. InChIKey: ZMLAEOWQOQIWJT-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 4-[[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid |
| InChIKey | ZMLAEOWQOQIWJT-SNVBAGLBSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)NC(=O)CCC(=O)O)O |
Computed by PubChem (NCBI)