CAS 374816-32-7 appears in our catalog under these names: Potassium Clavulanate EP Impurity G, 4-(((1S)-1-Carboxy-2-(4-hydroxyphenyl)ethyl)amino)-4-oxobutanoic Acid (N-(Hydrogensuccinyl)tyrosine), N-Succinyl-L-tyrosine, >95% (HPLC), N-Succinyl-L-tyrosine, (S)-4-((1-Carboxy-2-(4-hydroxyphenyl)ethyl)amino)-4-oxobutanoic acid, 95% HPLC, 95% HPLC. Offered by: Chemat Brand, Mikromol, TRC, Biosynth, Chemat. Available pack sizes: on request, 25mg, 50mg, 5mg, 2mg, 1mg, 10mg, 100mg.
4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid (CAS 374816-32-7) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: 4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid. InChIKey: ZMLAEOWQOQIWJT-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 4-[[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-4-oxobutanoic acid |
| InChIKey | ZMLAEOWQOQIWJT-JTQLQIEISA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC(=O)CCC(=O)O)O |
Computed by PubChem (NCBI)