cas: 1255792-05-2 — see every product listed under this CAS number, including other names
alpha-Methyl-5-methoxy-2-nitro-4-(2-propyn-1-yloxy)benzyl Alcohol, 95%, 95% (CAS 1255792-05-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DF2W-10g |
| cas | 1255792-05-2 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2776.40 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1590.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(5-methoxy-2-nitro-4-prop-2-ynoxyphenyl)ethanol (CAS 1255792-05-2) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 1-(5-methoxy-2-nitro-4-prop-2-ynoxyphenyl)ethanol. InChIKey: DACNMURXMLMAPR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 1-(5-methoxy-2-nitro-4-prop-2-ynoxyphenyl)ethanol |
| InChIKey | DACNMURXMLMAPR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1[N+](=O)[O-])OCC#C)OC)O |
Computed by PubChem (NCBI)