cas: 610-09-3 — see every product listed under this CAS number, including other names
cis-Cyclohexane-1,2-dicarboxylic acid, 98%, 98% (CAS 610-09-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IASA-10g |
| cas | 610-09-3 |
| size | 10g |
| availability | 8000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 500g | 264.00 Pln | |
| Chemat | 1kg | 448.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 610-09-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-OLQVQODUSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-OLQVQODUSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)