CAS 46022-05-3 appears in our catalog under these names: Perospirone Impurity 33, (R,R)-1,2-Cyclohexanedicarboxylic Acid, >95% (HPLC), (1R,2R)–Cyclohexane–1,2–dicarboxylic Acid, (1R,2R)-Cyclohexane-1,2-dicarboxylic acid, 98+% , (1R,2R)-1,2-Cyclohexanedicarboxylic Acid, >98.0%(GC)(T). Offered by: Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: on request, 1g, 100g, 5g, 250mg, 10g, 25g, 500g.
Trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid (CAS 46022-05-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)