cas: 32133-38-3 — see every product listed under this CAS number, including other names
dl-2,5-Difluorophenylalanine, 97% (CAS 32133-38-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004857-500MG |
| cas | 32133-38-3 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 190.58 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 997.58 Pln | |
| Fluorochem | 10g | 1934.75 Pln | |
| Fluorochem | 25g | 4746.26 Pln | |
| Fluorochem | 50g | 8031.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-3-(2,5-difluorophenyl)propanoic acid (CAS 32133-38-3) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2-amino-3-(2,5-difluorophenyl)propanoic acid. InChIKey: YHYQITHAFYELNW-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2-amino-3-(2,5-difluorophenyl)propanoic acid |
| InChIKey | YHYQITHAFYELNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC(C(=O)O)N)F |
Computed by PubChem (NCBI)