cas: 134098-70-7 — see every product listed under this CAS number, including other names
fmoc-d-asp-otbu, 95% (CAS 134098-70-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045453-1G |
| cas | 134098-70-7 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 50g | 732.05 Pln | |
| Fluorochem | 100g | 1268.32 Pln | |
| Fluorochem | 500g | 5834.42 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 134098-70-7) is a chemical compound with the molecular formula C23H25NO6 and a molecular weight of 411.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: VZXQYACYLGRQJU-LJQANCHMSA-N.
| Molecular formula | C23H25NO6 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | VZXQYACYLGRQJU-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)