cas: 2089289-02-9 — see every product listed under this CAS number, including other names
methyl 2,2-dimethyl-4-oxo-3,4-dihydro-2H-1-benzopyran-7-carboxylate, ≥97%, ≥97% (CAS 2089289-02-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DEN8-100mg |
| cas | 2089289-02-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1264.40 Pln | |
| Chemat | 5g | 3395.60 Pln | |
| Chemat | 10g | 5843.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,2-dimethyl-4-oxo-3H-chromene-7-carboxylate (CAS 2089289-02-9) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: methyl 2,2-dimethyl-4-oxo-3H-chromene-7-carboxylate. InChIKey: FQDYSBCDZCLIMG-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | methyl 2,2-dimethyl-4-oxo-3H-chromene-7-carboxylate |
| InChIKey | FQDYSBCDZCLIMG-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C(O1)C=C(C=C2)C(=O)OC)C |
Computed by PubChem (NCBI)