cas: 883-99-8 — see every product listed under this CAS number, including other names
methyl 3-hydroxy-2-naphthoate, 98% (CAS 883-99-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F373507-1G |
| cas | 883-99-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 50g | 200.99 Pln | |
| Fluorochem | 100g | 325.94 Pln | |
| Fluorochem | 250g | 643.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-hydroxynaphthalene-2-carboxylate (CAS 883-99-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 3-hydroxynaphthalene-2-carboxylate. InChIKey: YVVBECLPRBAATK-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 3-hydroxynaphthalene-2-carboxylate |
| InChIKey | YVVBECLPRBAATK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC=CC=C2C=C1O |
Computed by PubChem (NCBI)