cas: 61441-09-6 — see every product listed under this CAS number, including other names
methyl 6-bromobenzo[d][1,3]dioxole-5-carboxylate, 95%, 95% (CAS 61441-09-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELOQ-100mg |
| cas | 61441-09-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1514.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-bromo-1,3-benzodioxole-5-carboxylate (CAS 61441-09-6) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: methyl 6-bromo-1,3-benzodioxole-5-carboxylate. InChIKey: OOWBNMSDTXJYGE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | methyl 6-bromo-1,3-benzodioxole-5-carboxylate |
| InChIKey | OOWBNMSDTXJYGE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1Br)OCO2 |
Computed by PubChem (NCBI)