cas: 92149-07-0 — see every product listed under this CAS number, including other names
p-MeO-Phen 97% (CAS 92149-07-0) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A225833-500g |
| cas | 92149-07-0 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 18442.94 Pln | |
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 1232.56 Pln | |
| Ambeed | 100g | 4664.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A225833 |
4,7-dimethoxy-1,10-phenanthroline (CAS 92149-07-0) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 4,7-dimethoxy-1,10-phenanthroline. InChIKey: ZPGVCQYKXIQWTP-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 4,7-dimethoxy-1,10-phenanthroline |
| InChIKey | ZPGVCQYKXIQWTP-UHFFFAOYSA-N |
| SMILES | COC1=C2C=CC3=C(C=CN=C3C2=NC=C1)OC |
Computed by PubChem (NCBI)