CAS 1000018-01-8 is the registry number for Ethyl 3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylate (CAS 1000018-01-8) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: ethyl 3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: ZVCJPYORUMKIEO-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | ethyl 3,5-dichloroimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | ZVCJPYORUMKIEO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C(=N1)C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)