CAS 19506-33-3 is the registry number for 2,3-Dichloro-5,8-dimethoxyquinoxaline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2,3-dichloro-5,8-dimethoxyquinoxaline (CAS 19506-33-3) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: 2,3-dichloro-5,8-dimethoxyquinoxaline. InChIKey: GTLMXSJGZBBPFV-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | 2,3-dichloro-5,8-dimethoxyquinoxaline |
| InChIKey | GTLMXSJGZBBPFV-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)OC)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)