Products 1343602-10-7
CAS 1343602-10-7 is the registry number for (3-(2,6-Dichlorobenzyl)-1,2,4-oxadiazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[(2,6-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanol (CAS 1343602-10-7) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: [3-[(2,6-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanol. InChIKey: LSERHOQHTJTYED-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | [3-[(2,6-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanol |
| InChIKey | LSERHOQHTJTYED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC2=NOC(=N2)CO)Cl |
Computed by PubChem (NCBI)