Products 30192-45-1
CAS 30192-45-1 is the registry number for Ethyl 5,6-dichloro-1H-benzo[d]imidazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,6-dichloro-1H-benzimidazole-2-carboxylate (CAS 30192-45-1) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: ethyl 5,6-dichloro-1H-benzimidazole-2-carboxylate. InChIKey: OKMWUIJSVITHHO-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | ethyl 5,6-dichloro-1H-benzimidazole-2-carboxylate |
| InChIKey | OKMWUIJSVITHHO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=CC(=C(C=C2N1)Cl)Cl |
Computed by PubChem (NCBI)