CAS 61948-62-7 is the registry number for 2,4-Dichloro-7,8-dimethoxyquinazoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7,8-dimethoxyquinazoline (CAS 61948-62-7) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: 2,4-dichloro-7,8-dimethoxyquinazoline. InChIKey: CRFHXALYMCGBCL-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | 2,4-dichloro-7,8-dimethoxyquinazoline |
| InChIKey | CRFHXALYMCGBCL-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=NC(=N2)Cl)Cl)OC |
Computed by PubChem (NCBI)