CAS 1267379-66-7 appears in our catalog under these names: 4-(2,5-Dichlorophenyl)piperazine-2,6-dione, 98%, 4-(2,5-Dichlorophenyl)piperazine-2,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(2,5-dichlorophenyl)piperazine-2,6-dione (CAS 1267379-66-7) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: 4-(2,5-dichlorophenyl)piperazine-2,6-dione. InChIKey: WFJQKDIYKMIVCU-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | 4-(2,5-dichlorophenyl)piperazine-2,6-dione |
| InChIKey | WFJQKDIYKMIVCU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=O)CN1C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)