CAS 1821033-10-6 is the registry number for 2-Cyano-N-(3,5-dichloro-4-methoxyphenyl)-acetamide. Offered by: TRC. Available pack sizes: 100mg.
2-cyano-N-(3,5-dichloro-4-methoxyphenyl)acetamide (CAS 1821033-10-6) is a chemical compound with the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. IUPAC name: 2-cyano-N-(3,5-dichloro-4-methoxyphenyl)acetamide. InChIKey: VSUJWCWXTCIOAI-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | 2-cyano-N-(3,5-dichloro-4-methoxyphenyl)acetamide |
| InChIKey | VSUJWCWXTCIOAI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)NC(=O)CC#N)Cl |
Computed by PubChem (NCBI)