Products 1000340-53-3
CAS 1000340-53-3 appears in our catalog under these names: 7-Methyl-1H-indazole-3-carboxylic acid, 7-Methyl-1h-indazole-3-carboxylic acid, 95%, 7-Methyl-1H-indazole-3-carboxylic acid, 98%, 7-Methyl-1H-indazole-3-carboxylic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 100mg, 50mg, 500mg.
7-methyl-2H-indazole-3-carboxylic acid (CAS 1000340-53-3) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methyl-2H-indazole-3-carboxylic acid. InChIKey: BRQJRWNBYGCLDU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methyl-2H-indazole-3-carboxylic acid |
| InChIKey | BRQJRWNBYGCLDU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=C(NN=C12)C(=O)O |
Computed by PubChem (NCBI)