CAS 1000524-74-2 appears in our catalog under these names: 2-(4-(Difluoromethyl)phenyl)acetic acid, 2-(4-(Difluoromethyl)phenyl)acetic acid 95%, 2-(4-(DIFLUOROMETHYL)PHENYL)ACETIC ACID, 96%, 2-[4-(difluoromethyl)phenyl]acetic acid, 95%, 95%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-[4-(difluoromethyl)phenyl]acetic acid (CAS 1000524-74-2) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 2-[4-(difluoromethyl)phenyl]acetic acid. InChIKey: BZFPRXKQMXOTCW-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)phenyl]acetic acid |
| InChIKey | BZFPRXKQMXOTCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C(F)F |
Computed by PubChem (NCBI)