Products 1000530-96-0

CAS 1000530-96-0 is the registry number for 3-(3-Fluorophenyl)-3-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(3-fluorophenyl)-3-oxopropanoic acid (CAS 1000530-96-0) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-(3-fluorophenyl)-3-oxopropanoic acid. InChIKey: LUEQCQBQTZGUFD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7FO3
Molecular weight182.15 g/mol
IUPAC name3-(3-fluorophenyl)-3-oxopropanoic acid
InChIKeyLUEQCQBQTZGUFD-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)C(=O)CC(=O)O

Computed by PubChem (NCBI)