Products 10006-67-4
CAS 10006-67-4 is the registry number for 1-(3,4-Dichlorophenyl)-2-oxopyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(3,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxylic acid (CAS 10006-67-4) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxylic acid. InChIKey: UZCXVOTUVYLHJI-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO3 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2-oxopyrrolidine-3-carboxylic acid |
| InChIKey | UZCXVOTUVYLHJI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1C(=O)O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)