Products 2131751-70-5
CAS 2131751-70-5 is the registry number for 4,5-Dichloro-6-methoxy-1-methyl-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-6-methoxy-1-methylindole-2-carboxylic acid (CAS 2131751-70-5) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: 4,5-dichloro-6-methoxy-1-methylindole-2-carboxylic acid. InChIKey: FGSYITZVUGTUGA-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO3 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 4,5-dichloro-6-methoxy-1-methylindole-2-carboxylic acid |
| InChIKey | FGSYITZVUGTUGA-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C(=C2C=C1C(=O)O)Cl)Cl)OC |
Computed by PubChem (NCBI)