Products 91064-23-2

CAS 91064-23-2 is the registry number for 1-(2,4-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g.

Structural formula: {0} (CAS {1})

1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 91064-23-2) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: GOCPCJNONCMHLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9Cl2NO3
Molecular weight274.10 g/mol
IUPAC name1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyGOCPCJNONCMHLZ-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=C(C=C(C=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)