Products 91064-26-5

CAS 91064-26-5 is the registry number for 1-(3,5-Dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 91064-26-5) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: GPHFWWLZHYCCJC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9Cl2NO3
Molecular weight274.10 g/mol
IUPAC name1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyGPHFWWLZHYCCJC-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC(=CC(=C2)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)