CAS 299920-48-2 is the registry number for 1-(2,3-Dichlorophenyl)-5-oxo-3-pyrrolidinecarboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 299920-48-2) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: FGFXAMXLGBFURZ-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO3 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | FGFXAMXLGBFURZ-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=C(C(=CC=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)