CAS 2819669-65-1 is the registry number for Methyl 2-(aminomethyl)-3,5-dichlorobenzofuran-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(aminomethyl)-3,5-dichloro-1-benzofuran-7-carboxylate (CAS 2819669-65-1) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: methyl 2-(aminomethyl)-3,5-dichloro-1-benzofuran-7-carboxylate. InChIKey: FIFVDBNSIIKEDC-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO3 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | methyl 2-(aminomethyl)-3,5-dichloro-1-benzofuran-7-carboxylate |
| InChIKey | FIFVDBNSIIKEDC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC2=C1OC(=C2Cl)CN)Cl |
Computed by PubChem (NCBI)