CAS 1326810-45-0 is the registry number for 3-(3,4-Dichlorophenyl)-5-methyl-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dichlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid (CAS 1326810-45-0) is a chemical compound with the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid. InChIKey: CQGNRWFHWOALEC-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2NO3 |
|---|---|
| Molecular weight | 274.10 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-5-methyl-4H-1,2-oxazole-5-carboxylic acid |
| InChIKey | CQGNRWFHWOALEC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=NO1)C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)