CAS 100063-18-1 appears in our catalog under these names: Methyl 4-(4-methyl-1,3-thiazol-2-yl)benzoate, 95%, Methyl 4-(4-methyl-1,3-thiazol-2-yl)benzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Methyl 4-(4-methyl-1,3-thiazol-2-yl)benzoate (CAS 100063-18-1) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: methyl 4-(4-methyl-1,3-thiazol-2-yl)benzoate. InChIKey: FFONRRVXTKXMDU-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | methyl 4-(4-methyl-1,3-thiazol-2-yl)benzoate |
| InChIKey | FFONRRVXTKXMDU-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)