Products 1001200-43-6
CAS 1001200-43-6 is the registry number for Methyl 6-(dibromomethyl)nicotinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Methyl 6-(dibromomethyl)pyridine-3-carboxylate (CAS 1001200-43-6) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: methyl 6-(dibromomethyl)pyridine-3-carboxylate. InChIKey: LTQPTZCKCBJVET-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | methyl 6-(dibromomethyl)pyridine-3-carboxylate |
| InChIKey | LTQPTZCKCBJVET-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)C(Br)Br |
Computed by PubChem (NCBI)