Products 1001401-62-2
CAS 1001401-62-2 appears in our catalog under these names: 2–(2H–1,2,3–triazol–2–yl)benzoic acid, 2-(2H-1,2,3-TRIAZOL-2-YL)BENZOIC ACID, 2-(2H-1,2,3-Triazol-2-yl)benzoic acid, 95%, 2-(2H-1,2,3-Triazol-2-yl)benzoic acid 97%, 2-(2H-1,2,3-Triazol-2-yl)benzoic acid, 97%, 97%. Offered by: GLPBio, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, on request.
2-(triazol-2-yl)benzoic acid (CAS 1001401-62-2) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 2-(triazol-2-yl)benzoic acid. InChIKey: UTENUPFWBIFKPW-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-(triazol-2-yl)benzoic acid |
| InChIKey | UTENUPFWBIFKPW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N2N=CC=N2 |
Computed by PubChem (NCBI)