Products 10023-11-7
CAS 10023-11-7 is the registry number for Deoxyfrenolicin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1R,3S)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid (CAS 10023-11-7) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: 2-[(1R,3S)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid. InChIKey: XWXZEYLPRXYHQC-TVQRCGJNSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 2-[(1R,3S)-9-hydroxy-5,10-dioxo-1-propyl-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetic acid |
| InChIKey | XWXZEYLPRXYHQC-TVQRCGJNSA-N |
| SMILES | CCC[C@@H]1C2=C(C[C@H](O1)CC(=O)O)C(=O)C3=C(C2=O)C(=CC=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Deoxyfrenolicin, orb3023118