CAS 10040-91-2 appears in our catalog under these names: Hydantoin Impurity 7, Hydantoin Impurity 25. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione (CAS 10040-91-2) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione. InChIKey: NKQBXYVAZTZVMV-YVMONPNESA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | (5Z)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| InChIKey | NKQBXYVAZTZVMV-YVMONPNESA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C\2/C(=O)NC(=O)N2)OC |
Computed by PubChem (NCBI)