CAS 1004775-34-1 appears in our catalog under these names: (4-(difluoromethoxy)-2-fluorophenyl)boronic acid, 95+%, 95+%, (4-(Difluoromethoxy)-2-fluorophenyl)boronic acid, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[4-(difluoromethoxy)-2-fluorophenyl]boronic acid (CAS 1004775-34-1) is a chemical compound with the molecular formula C7H6BF3O3 and a molecular weight of 205.93 g/mol. IUPAC name: [4-(difluoromethoxy)-2-fluorophenyl]boronic acid. InChIKey: PLPKXPNIMSNXAF-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3 |
|---|---|
| Molecular weight | 205.93 g/mol |
| IUPAC name | [4-(difluoromethoxy)-2-fluorophenyl]boronic acid |
| InChIKey | PLPKXPNIMSNXAF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(F)F)F)(O)O |
Computed by PubChem (NCBI)