CAS 1005452-67-4 is the registry number for 7-Bromo-4,6-dichloroquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-4,6-dichloroquinoline (CAS 1005452-67-4) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-4,6-dichloroquinoline. InChIKey: VOQVYRBDHUBQDW-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-4,6-dichloroquinoline |
| InChIKey | VOQVYRBDHUBQDW-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C(=CC2=C1Cl)Cl)Br |
Computed by PubChem (NCBI)