CAS 1005614-77-6 appears in our catalog under these names: 1-Ethyl-3,5-dimethyl-1h-pyrazole-4-sulfonyl chloride, 95%, 1-Ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-ethyl-3,5-dimethylpyrazole-4-sulfonyl chloride (CAS 1005614-77-6) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: 1-ethyl-3,5-dimethylpyrazole-4-sulfonyl chloride. InChIKey: RQCJMZFSOMFEOT-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 1-ethyl-3,5-dimethylpyrazole-4-sulfonyl chloride |
| InChIKey | RQCJMZFSOMFEOT-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)