CAS 17852-67-4 appears in our catalog under these names: 4-(Methylsulfonyl)phenylhydrazine hydrochloride, 4-(Methylsulfonyl)phenylhydrazine hydrochloride, 97%, 4-(Methylsulfonyl)phenylhydrazine hydrochloride, 95%, (4-(Methylsulfonyl)phenyl)hydrazine hydrochloride 95%, (4-(Methylsulfonyl)Phenyl)Hydrazine Hydrochloride, 95%, 95%. Offered by: Biosynth, Combi-blocks, Thermo Scientific (Acros), Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 100g, 1g, 500g, 5g, 2.5g, 10g.
(4-methylsulfonylphenyl)hydrazine;hydrochloride (CAS 17852-67-4) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: (4-methylsulfonylphenyl)hydrazine;hydrochloride. InChIKey: QVCMFSJTNVQJFG-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | (4-methylsulfonylphenyl)hydrazine;hydrochloride |
| InChIKey | QVCMFSJTNVQJFG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)NN.Cl |
Computed by PubChem (NCBI)