CAS 848141-14-0 appears in our catalog under these names: ([5-(Methylsulfonyl)pyridin-2-yl]methyl)amine hydrochloride, 95%, (5-(Methylsulfonyl)pyridin-2-yl)methanamine hydrochloride, 98%, (5–(Methylsulfonyl)pyridin–2–yl)methanamine hydrochloride, (5-(Methylsulfonyl)pyridin-2-yl)methanamine hydrochloride, 98%, 98%, ([5-(METHYLSULFONYL)PYRIDIN-2-YL]METHYL)AMINE HCL, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(5-methylsulfonyl-2-pyridinyl)methanamine;hydrochloride (CAS 848141-14-0) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: (5-methylsulfonyl-2-pyridinyl)methanamine;hydrochloride. InChIKey: PIEMVHRCZDIVOT-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | (5-methylsulfonyl-2-pyridinyl)methanamine;hydrochloride |
| InChIKey | PIEMVHRCZDIVOT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)