Products 1197826-26-8
CAS 1197826-26-8 appears in our catalog under these names: N-(Pyridin-4-ylmethyl)methanesulfonamide hydrochloride, 95%, N-(Pyridin-4-ylmethyl)methanesulfonamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
N-(pyridin-4-ylmethyl)methanesulfonamide;hydrochloride (CAS 1197826-26-8) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: N-(pyridin-4-ylmethyl)methanesulfonamide;hydrochloride. InChIKey: RJPPQZBFCZGYBF-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | N-(pyridin-4-ylmethyl)methanesulfonamide;hydrochloride |
| InChIKey | RJPPQZBFCZGYBF-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCC1=CC=NC=C1.Cl |
Computed by PubChem (NCBI)