CAS 670280-13-4 appears in our catalog under these names: 3-(Aminomethyl)benzenesulfonamide hydrochloride, 96%, 3-(Aminomethyl)benzenesulfonamide HCl, 3-(Aminomethyl)benzenesulfonamide hydrochloride 96%, 3-(Aminomethyl)benzenesulfonamide, HCl, 96%, 96%, 3-(Aminomethyl)benzenesulfonamide hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 2,5g.
3-(aminomethyl)benzenesulfonamide;hydrochloride (CAS 670280-13-4) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: 3-(aminomethyl)benzenesulfonamide;hydrochloride. InChIKey: CMDWAIOSJPELDH-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 3-(aminomethyl)benzenesulfonamide;hydrochloride |
| InChIKey | CMDWAIOSJPELDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)CN.Cl |
Computed by PubChem (NCBI)