CAS 53266-92-5 is the registry number for Ethyl 2-amino-4-methylthiazole-5-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
Ethyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride (CAS 53266-92-5) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: ethyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride. InChIKey: DCTXAUJLGMDHAJ-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | ethyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
| InChIKey | DCTXAUJLGMDHAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N)C.Cl |
Computed by PubChem (NCBI)