CAS 1609399-76-9 is the registry number for 2-[(Dimethylamino)methyl]-1,3-thiazole-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 1609399-76-9) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: 2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: NXPZBXCUSKWSIB-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 2-[(dimethylamino)methyl]-1,3-thiazole-4-carboxylic acid;hydrochloride |
| InChIKey | NXPZBXCUSKWSIB-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC(=CS1)C(=O)O.Cl |
Computed by PubChem (NCBI)