Products 1006453-09-3

CAS 1006453-09-3 is the registry number for 4-(4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

4-(4-chloro-3,5-dimethylpyrazol-1-yl)butanoic acid (CAS 1006453-09-3) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 4-(4-chloro-3,5-dimethylpyrazol-1-yl)butanoic acid. InChIKey: PYFAYCOFOFQTEP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2O2
Molecular weight216.66 g/mol
IUPAC name4-(4-chloro-3,5-dimethylpyrazol-1-yl)butanoic acid
InChIKeyPYFAYCOFOFQTEP-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CCCC(=O)O)C)Cl

Computed by PubChem (NCBI)