CAS 1006568-14-4 appears in our catalog under these names: 3-(3-Nitro-1h-pyrazol-1-yl)propanenitrile, 95%, 3-(3-Nitro-1H-pyrazol-1-yl)propanenitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(3-nitropyrazol-1-yl)propanenitrile (CAS 1006568-14-4) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: 3-(3-nitropyrazol-1-yl)propanenitrile. InChIKey: UCIMSXFQJXRPGJ-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 166.14 g/mol |
| IUPAC name | 3-(3-nitropyrazol-1-yl)propanenitrile |
| InChIKey | UCIMSXFQJXRPGJ-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1[N+](=O)[O-])CCC#N |
Computed by PubChem (NCBI)