CAS 1173018-93-3 appears in our catalog under these names: 3-Methylxanthine-13C4,15N3, 3-Methyl-3,7-dihydro-1H-purine-2,6-dione, 98%, 7-Methylxanthine-13C4, 15N3. Offered by: MedChemExpress, Chemat Brand, TRC, Chemat. Available pack sizes: 5mg, 1mg, on request, 2mg.
7-methyl-3H-purine-2,6-dione (CAS 1173018-93-3) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 173.09 g/mol. IUPAC name: 7-methyl-3H-purine-2,6-dione. InChIKey: PFWLFWPASULGAN-JVYICBGUSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 173.09 g/mol |
| IUPAC name | 7-methyl-3H-purine-2,6-dione |
| InChIKey | PFWLFWPASULGAN-JVYICBGUSA-N |
| SMILES | CN1C=[15N][13C]2=[13C]1[13C](=O)[15NH][13C](=O)[15NH]2 |
Computed by PubChem (NCBI)