CAS 119584-65-5 appears in our catalog under these names: 1,4,6,7-Tetrahydroimidazo[4,5-e][1,4]diazepine-5,8-dione, 95%, 1,4,6,7-tetrahydroimidazo[4,5-e][1,4]diazepine-5,8-dione. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1,4,6,7-tetrahydroimidazo[4,5-e][1,4]diazepine-5,8-dione (CAS 119584-65-5) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: 1,4,6,7-tetrahydroimidazo[4,5-e][1,4]diazepine-5,8-dione. InChIKey: FXQGXBGGCANVFZ-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 166.14 g/mol |
| IUPAC name | 1,4,6,7-tetrahydroimidazo[4,5-e][1,4]diazepine-5,8-dione |
| InChIKey | FXQGXBGGCANVFZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C(=O)N1)NC=N2 |
Computed by PubChem (NCBI)