CAS 17338-96-4 appears in our catalog under these names: 8-Methylxanthine, 95%, 8-Methylxanthine. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 50mg, 5mg, 10000mg.
8-methyl-3,7-dihydropurine-2,6-dione (CAS 17338-96-4) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: 8-methyl-3,7-dihydropurine-2,6-dione. InChIKey: RTAPDZBZLSXHQQ-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 166.14 g/mol |
| IUPAC name | 8-methyl-3,7-dihydropurine-2,6-dione |
| InChIKey | RTAPDZBZLSXHQQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)