Products 64074-25-5

CAS 64074-25-5 is the registry number for Methyl 1-(cyanomethyl)-1h-1,2,4-triazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-(cyanomethyl)-1,2,4-triazole-3-carboxylate (CAS 64074-25-5) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: methyl 1-(cyanomethyl)-1,2,4-triazole-3-carboxylate. InChIKey: JRAQCDVKAYYHHD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N4O2
Molecular weight166.14 g/mol
IUPAC namemethyl 1-(cyanomethyl)-1,2,4-triazole-3-carboxylate
InChIKeyJRAQCDVKAYYHHD-UHFFFAOYSA-N
SMILESCOC(=O)C1=NN(C=N1)CC#N

Computed by PubChem (NCBI)